What is the molecular formula of caffeic acid?
C9H8O4Caffeic acid / Formula
Table of Contents
Is caffeic acid a phenol?
Caffeic acid (CA) is a phenolic compound synthesized by all plant species and is present in foods such as coffee, wine, tea, and popular medicines such as propolis. This phenolic acid and its derivatives have antioxidant, anti-inflammatory and anticarcinogenic activity.
What is C9H8O4?
Aspirin | C9H8O4 – PubChem.
What are the elements in C9H8O4?
Identification of Aspirin Chemical Compound
| Chemical Formula | C9H8O4 |
|---|---|
| Molecular Weight | 180.15742 g/mol |
| IUPAC Name | 2-(acetyloxy)benzoic acid |
| SMILES String | CC(=O)Oc1ccccc1C(O)=O |
| InChI | InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12) |
What type of atom is C9H8O4?
Likewise, the molecular mass of an aspirin molecule, C9H8O4, is the sum of the atomic masses of nine carbon atoms, eight hydrogen atoms, and four oxygen atoms, which amounts to 180.15 amu (Figure 3.3).
What is the empirical formula for caffeic acid?
C9H8O4
Caffeic acid | C9H8O4 – PubChem.
How is caffeic acid produced?
Currently, caffeic acid is commonly produced by extraction from plant sources, such as coffee beans. Chemical or enzymatic hydrolysis of caffeoylquinic acid derivatives is also employed to produce caffeic acid [13, 14].
What is the name of C9H8O4?
Aspirin
Aspirin | C9H8O4 – PubChem.
What contains caffeic acid?
Caffeic acid is a chemical found in many plants and foods. Coffee is the primary source of caffeic acid in the human diet. However, it can be found in other food sources such as apples, artichoke, berries, olives, and pears. Wine also contains a significant amount of caffeic acid.
What does C9H8O4 stand for?
What substance is C9H8O4?
5-Acetylsalicylic acid
5-Acetylsalicylic acid | C9H8O4 – PubChem.
What is the molecular mass of C9H8O4?
Answer and Explanation: The molecular weight of aspirin with a chemical formula for C9H8O4 is 180.157 grams per mole.
What is the molecular weight of C9H8O4?
C9H8O4 molecular weight. Molar mass of C9H8O4 = 180.15742 g/mol This compound is also known as Aspirin. Convert grams C9H8O4 to moles or moles C9H8O4 to grams Molecular weight calculation: 12.0107*9 + 1.00794*8 + 15.9994*4.
Is SO3 polar or nonpolar or ionic?
The sulfur trioxide ( SO3 ) compound contains three S=O group which is polar . because oxygen is more electronegative than sulfur atom . But the resultant dipole moment of SO3 is zero .
What is the Lewis structure for sulfur trioxide?
Sulfur trioxide, or sulfur (VI) oxide, whose Lewis structure is proposed as ( O =) 2 S + − O −. This is barely a gas under standard conditions, and is the acid anhydride of sulfuric acid, H 2 S O 4.
Why is SO3 sp2 hybridized?
This answer for SO 3 comes from a robotic use of formal charge without regard to actual bonding that must be occurring in the molecule. The real problem is this, you cannot simultaneously say that a molecule is sp 2 hybridized and give it three double bonds.
